C27H23FN2O — CID 67307773
(2R)-2-(3-fluoro-4-phenylphenyl)-N-[4-(2-methyl-4-pyridinyl)phenyl]propanamide (PubChem CID 67307773) has the molecular formula C27H23FN2O and a molecular weight of 410.49 g/mol. Its IUPAC name is (2R)-2-(3-fluoro-4-phenylphenyl)-N-[4-(2-methyl-4-pyridinyl)phenyl]propanamide.
| Compound Name | (2R)-2-(3-fluoro-4-phenylphenyl)-N-[4-(2-methyl-4-pyridinyl)phenyl]propanamide |
|---|---|
| PubChem CID | 67307773 |
| Molecular Formula | C27H23FN2O |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | (2R)-2-(3-fluoro-4-phenylphenyl)-N-[4-(2-methyl-4-pyridinyl)phenyl]propanamide |
| SMILES | Cc1cc(-c2ccc(NC(=O)[C@H](C)c3ccc(-c4ccccc4)c(F)c3)cc2)ccn1 |
| InChI | InChI=1S/C27H23FN2O/c1-18-16-23(14-15-29-18)20-8-11-24(12-9-20)30-27(31)19(2)22-10-13-25(26(28)17-22)21-6-4-3-5-7-21/h3-17,19H,1-2H3,(H,30,31)/t19-/m1/s1 |
| InChIKey | AGNDMLXIDSOOGG-LJQANCHMSA-N |
| XLogP | 6.61 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |