C28H23N3O — CID 67309019
2-[3-(3-cyanophenyl)phenyl]-N-[4-(2-methyl-4-pyridinyl)phenyl]propanamide (PubChem CID 67309019) has the molecular formula C28H23N3O and a molecular weight of 417.51 g/mol. Its IUPAC name is 2-[3-(3-cyanophenyl)phenyl]-N-[4-(2-methyl-4-pyridinyl)phenyl]propanamide.
| Compound Name | 2-[3-(3-cyanophenyl)phenyl]-N-[4-(2-methyl-4-pyridinyl)phenyl]propanamide |
|---|---|
| PubChem CID | 67309019 |
| Molecular Formula | C28H23N3O |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 2-[3-(3-cyanophenyl)phenyl]-N-[4-(2-methyl-4-pyridinyl)phenyl]propanamide |
| SMILES | Cc1cc(-c2ccc(NC(=O)C(C)c3cccc(-c4cccc(C#N)c4)c3)cc2)ccn1 |
| InChI | InChI=1S/C28H23N3O/c1-19-15-26(13-14-30-19)22-9-11-27(12-10-22)31-28(32)20(2)23-6-4-8-25(17-23)24-7-3-5-21(16-24)18-29/h3-17,20H,1-2H3,(H,31,32) |
| InChIKey | TXJRQLUWERMPAI-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |