C30H30N2O — CID 67309518
4-methyl-N-[4-(2-methyl-4-pyridinyl)phenyl]-2-(4-phenylphenyl)pentanamide (PubChem CID 67309518) has the molecular formula C30H30N2O and a molecular weight of 434.58 g/mol. Its IUPAC name is 4-methyl-N-[4-(2-methyl-4-pyridinyl)phenyl]-2-(4-phenylphenyl)pentanamide.
| Compound Name | 4-methyl-N-[4-(2-methyl-4-pyridinyl)phenyl]-2-(4-phenylphenyl)pentanamide |
|---|---|
| PubChem CID | 67309518 |
| Molecular Formula | C30H30N2O |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 4-methyl-N-[4-(2-methyl-4-pyridinyl)phenyl]-2-(4-phenylphenyl)pentanamide |
| SMILES | Cc1cc(-c2ccc(NC(=O)C(CC(C)C)c3ccc(-c4ccccc4)cc3)cc2)ccn1 |
| InChI | InChI=1S/C30H30N2O/c1-21(2)19-29(26-11-9-24(10-12-26)23-7-5-4-6-8-23)30(33)32-28-15-13-25(14-16-28)27-17-18-31-22(3)20-27/h4-18,20-21,29H,19H2,1-3H3,(H,32,33) |
| InChIKey | USHZTBRODQXXHJ-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |