C24H24BrFN2O — CID 123982115
2-(3-bromo-4-fluorophenyl)-4-methyl-N-[4-(2-methyl-4-pyridinyl)phenyl]pentanamide (PubChem CID 123982115) has the molecular formula C24H24BrFN2O and a molecular weight of 455.37 g/mol. Its IUPAC name is 2-(3-bromo-4-fluorophenyl)-4-methyl-N-[4-(2-methyl-4-pyridinyl)phenyl]pentanamide.
| Compound Name | 2-(3-bromo-4-fluorophenyl)-4-methyl-N-[4-(2-methyl-4-pyridinyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 123982115 |
| Molecular Formula | C24H24BrFN2O |
| Molecular Weight | 455.37 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 2-(3-bromo-4-fluorophenyl)-4-methyl-N-[4-(2-methyl-4-pyridinyl)phenyl]pentanamide |
| SMILES | Cc1cc(-c2ccc(NC(=O)C(CC(C)C)c3ccc(F)c(Br)c3)cc2)ccn1 |
| InChI | InChI=1S/C24H24BrFN2O/c1-15(2)12-21(19-6-9-23(26)22(25)14-19)24(29)28-20-7-4-17(5-8-20)18-10-11-27-16(3)13-18/h4-11,13-15,21H,12H2,1-3H3,(H,28,29) |
| InChIKey | FCUBIJLQWHHNMS-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.37 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |