C23H23BrN2O — CID 123178305
(2S)-2-(3-bromophenyl)-N-[4-(2-methyl-4-pyridinyl)phenyl]pentanamide (PubChem CID 123178305) has the molecular formula C23H23BrN2O and a molecular weight of 423.35 g/mol. Its IUPAC name is (2S)-2-(3-bromophenyl)-N-[4-(2-methyl-4-pyridinyl)phenyl]pentanamide.
| Compound Name | (2S)-2-(3-bromophenyl)-N-[4-(2-methyl-4-pyridinyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 123178305 |
| Molecular Formula | C23H23BrN2O |
| Molecular Weight | 423.35 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | (2S)-2-(3-bromophenyl)-N-[4-(2-methyl-4-pyridinyl)phenyl]pentanamide |
| SMILES | CCC[C@H](C(=O)Nc1ccc(-c2ccnc(C)c2)cc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C23H23BrN2O/c1-3-5-22(19-6-4-7-20(24)15-19)23(27)26-21-10-8-17(9-11-21)18-12-13-25-16(2)14-18/h4,6-15,22H,3,5H2,1-2H3,(H,26,27)/t22-/m0/s1 |
| InChIKey | FDZVOSWVAVOQSC-QFIPXVFZSA-N |
| XLogP | 6.34 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.35 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |