C25H27BrN2O2 — CID 123240301
2-(5-bromo-2-methoxyphenyl)-4-methyl-N-[4-(2-methyl-4-pyridinyl)phenyl]pentanamide (PubChem CID 123240301) has the molecular formula C25H27BrN2O2 and a molecular weight of 467.41 g/mol. Its IUPAC name is 2-(5-bromo-2-methoxyphenyl)-4-methyl-N-[4-(2-methyl-4-pyridinyl)phenyl]pentanamide.
| Compound Name | 2-(5-bromo-2-methoxyphenyl)-4-methyl-N-[4-(2-methyl-4-pyridinyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 123240301 |
| Molecular Formula | C25H27BrN2O2 |
| Molecular Weight | 467.41 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 2-(5-bromo-2-methoxyphenyl)-4-methyl-N-[4-(2-methyl-4-pyridinyl)phenyl]pentanamide |
| SMILES | COc1ccc(Br)cc1C(CC(C)C)C(=O)Nc1ccc(-c2ccnc(C)c2)cc1 |
| InChI | InChI=1S/C25H27BrN2O2/c1-16(2)13-23(22-15-20(26)7-10-24(22)30-4)25(29)28-21-8-5-18(6-9-21)19-11-12-27-17(3)14-19/h5-12,14-16,23H,13H2,1-4H3,(H,28,29) |
| InChIKey | GCOKPLXLMXQIGO-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.41 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |