C22H19ClFNO — CID 11233966
N-[2-(chloromethyl)phenyl]-2-(3-fluoro-4-phenylphenyl)propanamide (PubChem CID 11233966) has the molecular formula C22H19ClFNO and a molecular weight of 367.85 g/mol. Its IUPAC name is N-[2-(chloromethyl)phenyl]-2-(3-fluoro-4-phenylphenyl)propanamide.
| Compound Name | N-[2-(chloromethyl)phenyl]-2-(3-fluoro-4-phenylphenyl)propanamide |
|---|---|
| PubChem CID | 11233966 |
| Molecular Formula | C22H19ClFNO |
| Molecular Weight | 367.85 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | N-[2-(chloromethyl)phenyl]-2-(3-fluoro-4-phenylphenyl)propanamide |
| SMILES | CC(C(=O)Nc1ccccc1CCl)c1ccc(-c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C22H19ClFNO/c1-15(22(26)25-21-10-6-5-9-18(21)14-23)17-11-12-19(20(24)13-17)16-7-3-2-4-8-16/h2-13,15H,14H2,1H3,(H,25,26) |
| InChIKey | GSXKSRBWZSPZDN-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.85 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|