C30H28FNO4 — CID 70388178
2-(2,3-dimethylanilino)benzoic acid;2-(3-fluoro-4-phenylphenyl)propanoic acid (PubChem CID 70388178) has the molecular formula C30H28FNO4 and a molecular weight of 485.56 g/mol. Its IUPAC name is 2-(2,3-dimethylanilino)benzoic acid;2-(3-fluoro-4-phenylphenyl)propanoic acid.
| Compound Name | 2-(2,3-dimethylanilino)benzoic acid;2-(3-fluoro-4-phenylphenyl)propanoic acid |
|---|---|
| PubChem CID | 70388178 |
| Molecular Formula | C30H28FNO4 |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 2-(2,3-dimethylanilino)benzoic acid;2-(3-fluoro-4-phenylphenyl)propanoic acid |
| SMILES | CC(C(=O)O)c1ccc(-c2ccccc2)c(F)c1.Cc1cccc(Nc2ccccc2C(=O)O)c1C |
| InChI | InChI=1S/C15H13FO2.C15H15NO2/c1-10(15(17)18)12-7-8-13(14(16)9-12)11-5-3-2-4-6-11;1-10-6-5-9-13(11(10)2)16-14-8-4-3-7-12(14)15(17)18/h2-10H,1H3,(H,17,18);3-9,16H,1-2H3,(H,17,18) |
| InChIKey | XOQXHAXKZUJHQT-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |