About 1-bromopentane;2-(3-fluoro-4-phenylphenyl)propanoic acid
1-bromopentane;2-(3-fluoro-4-phenylphenyl)propanoic acid (PubChem CID 174803768) has the molecular formula C20H24BrFO2
and a molecular weight of 395.31 g/mol. Its IUPAC name is 1-bromopentane;2-(3-fluoro-4-phenylphenyl)propanoic acid.
Molecular Properties
| Compound Name | 1-bromopentane;2-(3-fluoro-4-phenylphenyl)propanoic acid |
| PubChem CID | 174803768 |
| Molecular Formula | C20H24BrFO2 |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 1-bromopentane;2-(3-fluoro-4-phenylphenyl)propanoic acid |
| SMILES | CC(C(=O)O)c1ccc(-c2ccccc2)c(F)c1.CCCCCBr |
| InChI | InChI=1S/C15H13FO2.C5H11Br/c1-10(15(17)18)12-7-8-13(14(16)9-12)11-5-3-2-4-6-11;1-2-3-4-5-6/h2-10H,1H3,(H,17,18);2-5H2,1H3 |
| InChIKey | UZLUPOMHRBPSET-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromopentane;2-(3-fluoro-4-phenylphenyl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromopentane;2-(3-fluoro-4-phenylphenyl)propanoic acid?
The IUPAC name of 1-bromopentane;2-(3-fluoro-4-phenylphenyl)propanoic acid (CID 174803768) is 1-bromopentane;2-(3-fluoro-4-phenylphenyl)propanoic acid.
What is the SMILES notation for 1-bromopentane;2-(3-fluoro-4-phenylphenyl)propanoic acid?
The canonical SMILES for 1-bromopentane;2-(3-fluoro-4-phenylphenyl)propanoic acid is CC(C(=O)O)c1ccc(-c2ccccc2)c(F)c1.CCCCCBr.
What is the InChIKey of 1-bromopentane;2-(3-fluoro-4-phenylphenyl)propanoic acid?
The InChIKey is UZLUPOMHRBPSET-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13FO2.C5H11Br/c1-10(15(17)18)12-7-8-13(14(16)9-12)11-5-3-2-4-6-11;1-2-3-4-5-6/h2-10H,1H3,(H,17,18);2-5H2,1H3.
What are the key properties of 1-bromopentane;2-(3-fluoro-4-phenylphenyl)propanoic acid?
1-bromopentane;2-(3-fluoro-4-phenylphenyl)propanoic acid has a molecular weight of 395.31 g/mol, XLogP of 6.25, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromopentane;2-(3-fluoro-4-phenylphenyl)propanoic acid is sourced from PubChem (CID 174803768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).