C26H33FO5 — CID 139790255
[(2S)-3-[2-(3-fluoro-4-phenylphenyl)propanoyloxy]-2-hydroxypropyl] octanoate (PubChem CID 139790255) has the molecular formula C26H33FO5 and a molecular weight of 444.54 g/mol. Its IUPAC name is [(2S)-3-[2-(3-fluoro-4-phenylphenyl)propanoyloxy]-2-hydroxypropyl] octanoate.
| Compound Name | [(2S)-3-[2-(3-fluoro-4-phenylphenyl)propanoyloxy]-2-hydroxypropyl] octanoate |
|---|---|
| PubChem CID | 139790255 |
| Molecular Formula | C26H33FO5 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | [(2S)-3-[2-(3-fluoro-4-phenylphenyl)propanoyloxy]-2-hydroxypropyl] octanoate |
| SMILES | CCCCCCCC(=O)OC[C@H](O)COC(=O)C(C)c1ccc(-c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C26H33FO5/c1-3-4-5-6-10-13-25(29)31-17-22(28)18-32-26(30)19(2)21-14-15-23(24(27)16-21)20-11-8-7-9-12-20/h7-9,11-12,14-16,19,22,28H,3-6,10,13,17-18H2,1-2H3/t19?,22-/m0/s1 |
| InChIKey | NDNWYYCFYSJBTO-BPARTEKVSA-N |
| XLogP | 5.40 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|