C21H25FO2 — CID 171478067
hexyl 2-(3-fluoro-4-phenylphenyl)propanoate (PubChem CID 171478067) has the molecular formula C21H25FO2 and a molecular weight of 328.43 g/mol. Its IUPAC name is hexyl 2-(3-fluoro-4-phenylphenyl)propanoate.
| Compound Name | hexyl 2-(3-fluoro-4-phenylphenyl)propanoate |
|---|---|
| PubChem CID | 171478067 |
| Molecular Formula | C21H25FO2 |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | hexyl 2-(3-fluoro-4-phenylphenyl)propanoate |
| SMILES | CCCCCCOC(=O)C(C)c1ccc(-c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C21H25FO2/c1-3-4-5-9-14-24-21(23)16(2)18-12-13-19(20(22)15-18)17-10-7-6-8-11-17/h6-8,10-13,15-16H,3-5,9,14H2,1-2H3 |
| InChIKey | SOVZGQACPMFKLZ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|