C23H23FO4 — CID 54280303
2-[2-(3-fluoro-4-phenylphenyl)propanoyloxy]ethyl hexa-2,4-dienoate (PubChem CID 54280303) has the molecular formula C23H23FO4 and a molecular weight of 382.43 g/mol. Its IUPAC name is 2-[2-(3-fluoro-4-phenylphenyl)propanoyloxy]ethyl hexa-2,4-dienoate.
| Compound Name | 2-[2-(3-fluoro-4-phenylphenyl)propanoyloxy]ethyl hexa-2,4-dienoate |
|---|---|
| PubChem CID | 54280303 |
| Molecular Formula | C23H23FO4 |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 2-[2-(3-fluoro-4-phenylphenyl)propanoyloxy]ethyl hexa-2,4-dienoate |
| SMILES | CC=CC=CC(=O)OCCOC(=O)C(C)c1ccc(-c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C23H23FO4/c1-3-4-6-11-22(25)27-14-15-28-23(26)17(2)19-12-13-20(21(24)16-19)18-9-7-5-8-10-18/h3-13,16-17H,14-15H2,1-2H3 |
| InChIKey | RQIRRKMMCPIETA-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|