C18H17FN2O8 — CID 176761405
2,3-dinitrooxypropyl 2-(3-fluoro-4-phenylphenyl)propanoate (PubChem CID 176761405) has the molecular formula C18H17FN2O8 and a molecular weight of 408.34 g/mol. Its IUPAC name is 2,3-dinitrooxypropyl 2-(3-fluoro-4-phenylphenyl)propanoate.
| Compound Name | 2,3-dinitrooxypropyl 2-(3-fluoro-4-phenylphenyl)propanoate |
|---|---|
| PubChem CID | 176761405 |
| Molecular Formula | C18H17FN2O8 |
| Molecular Weight | 408.34 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 2,3-dinitrooxypropyl 2-(3-fluoro-4-phenylphenyl)propanoate |
| SMILES | CC(C(=O)OCC(CO[N+](=O)[O-])O[N+](=O)[O-])c1ccc(-c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C18H17FN2O8/c1-12(18(22)27-10-15(29-21(25)26)11-28-20(23)24)14-7-8-16(17(19)9-14)13-5-3-2-4-6-13/h2-9,12,15H,10-11H2,1H3 |
| InChIKey | KLURHRGKWBZLBK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 131.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|