C22H25FN2O6 — CID 95242605
2-[[(2R)-2-(3-fluoro-4-phenylphenyl)propanoyl]amino]ethyl 2,2-dimethyl-3-nitrooxypropanoate (PubChem CID 95242605) has the molecular formula C22H25FN2O6 and a molecular weight of 432.45 g/mol. Its IUPAC name is 2-[[(2R)-2-(3-fluoro-4-phenylphenyl)propanoyl]amino]ethyl 2,2-dimethyl-3-nitrooxypropanoate.
| Compound Name | 2-[[(2R)-2-(3-fluoro-4-phenylphenyl)propanoyl]amino]ethyl 2,2-dimethyl-3-nitrooxypropanoate |
|---|---|
| PubChem CID | 95242605 |
| Molecular Formula | C22H25FN2O6 |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 2-[[(2R)-2-(3-fluoro-4-phenylphenyl)propanoyl]amino]ethyl 2,2-dimethyl-3-nitrooxypropanoate |
| SMILES | C[C@@H](C(=O)NCCOC(=O)C(C)(C)CO[N+](=O)[O-])c1ccc(-c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C22H25FN2O6/c1-15(17-9-10-18(19(23)13-17)16-7-5-4-6-8-16)20(26)24-11-12-30-21(27)22(2,3)14-31-25(28)29/h4-10,13,15H,11-12,14H2,1-3H3,(H,24,26)/t15-/m1/s1 |
| InChIKey | PRERGNWGMZEHND-OAHLLOKOSA-N |
| XLogP | 3.49 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|