C20H23FNO5- — CID 163161150
2-(3-fluoro-4-phenylphenyl)propyl 3-[hydroxy(oxido)amino]oxy-2,2-dimethylpropanoate (PubChem CID 163161150) has the molecular formula C20H23FNO5- and a molecular weight of 376.40 g/mol. Its IUPAC name is 2-(3-fluoro-4-phenylphenyl)propyl 3-[hydroxy(oxido)amino]oxy-2,2-dimethylpropanoate.
| Compound Name | 2-(3-fluoro-4-phenylphenyl)propyl 3-[hydroxy(oxido)amino]oxy-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 163161150 |
| Molecular Formula | C20H23FNO5- |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 2-(3-fluoro-4-phenylphenyl)propyl 3-[hydroxy(oxido)amino]oxy-2,2-dimethylpropanoate |
| SMILES | CC(COC(=O)C(C)(C)CON([O-])O)c1ccc(-c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C20H23FNO5/c1-14(12-26-19(23)20(2,3)13-27-22(24)25)16-9-10-17(18(21)11-16)15-7-5-4-6-8-15/h4-11,14,24H,12-13H2,1-3H3/q-1 |
| InChIKey | KFFMOIZYHHJOEB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|