C20H20FN2O6S2- — CID 154561425
2-(3-fluoro-4-phenylphenyl)-N-[2-(2-nitrooxyethyldisulfanyl)ethoxycarbonyl]propanimidate (PubChem CID 154561425) has the molecular formula C20H20FN2O6S2- and a molecular weight of 467.52 g/mol. Its IUPAC name is 2-(3-fluoro-4-phenylphenyl)-N-[2-(2-nitrooxyethyldisulfanyl)ethoxycarbonyl]propanimidate.
| Compound Name | 2-(3-fluoro-4-phenylphenyl)-N-[2-(2-nitrooxyethyldisulfanyl)ethoxycarbonyl]propanimidate |
|---|---|
| PubChem CID | 154561425 |
| Molecular Formula | C20H20FN2O6S2- |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | 2-(3-fluoro-4-phenylphenyl)-N-[2-(2-nitrooxyethyldisulfanyl)ethoxycarbonyl]propanimidate |
| SMILES | CC(C([O-])=NC(=O)OCCSSCCO[N+](=O)[O-])c1ccc(-c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C20H21FN2O6S2/c1-14(16-7-8-17(18(21)13-16)15-5-3-2-4-6-15)19(24)22-20(25)28-9-11-30-31-12-10-29-23(26)27/h2-8,13-14H,9-12H2,1H3,(H,22,24,25)/p-1 |
| InChIKey | HXKAIGAHHLLBRO-UHFFFAOYSA-M |
| XLogP | 4.08 |
| TPSA | 114.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|