C16H15FN3O- — CID 142954445
(1Z)-N-carbamimidoyl-2-(3-fluoro-4-phenylphenyl)propanimidate (PubChem CID 142954445) has the molecular formula C16H15FN3O- and a molecular weight of 284.31 g/mol. Its IUPAC name is (1Z)-N-carbamimidoyl-2-(3-fluoro-4-phenylphenyl)propanimidate.
| Compound Name | (1Z)-N-carbamimidoyl-2-(3-fluoro-4-phenylphenyl)propanimidate |
|---|---|
| PubChem CID | 142954445 |
| Molecular Formula | C16H15FN3O- |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | (1Z)-N-carbamimidoyl-2-(3-fluoro-4-phenylphenyl)propanimidate |
| SMILES | [H]/N=C(N)/N=C(\[O-])C(C)c1ccc(-c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C16H16FN3O/c1-10(15(21)20-16(18)19)12-7-8-13(14(17)9-12)11-5-3-2-4-6-11/h2-10H,1H3,(H4,18,19,20,21)/p-1 |
| InChIKey | OBLYINODDAVKJZ-UHFFFAOYSA-M |
| XLogP | 2.25 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|