C23H24FNO2 — CID 139088547
(2S)-2-(3-fluoro-4-phenylphenyl)propanoate;[(1S)-1-phenylethyl]azanium (PubChem CID 139088547) has the molecular formula C23H24FNO2 and a molecular weight of 365.45 g/mol. Its IUPAC name is (2S)-2-(3-fluoro-4-phenylphenyl)propanoate;[(1S)-1-phenylethyl]azanium.
| Compound Name | (2S)-2-(3-fluoro-4-phenylphenyl)propanoate;[(1S)-1-phenylethyl]azanium |
|---|---|
| PubChem CID | 139088547 |
| Molecular Formula | C23H24FNO2 |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | (2S)-2-(3-fluoro-4-phenylphenyl)propanoate;[(1S)-1-phenylethyl]azanium |
| SMILES | C[C@H](C(=O)[O-])c1ccc(-c2ccccc2)c(F)c1.C[C@H]([NH3+])c1ccccc1 |
| InChI | InChI=1S/C15H13FO2.C8H11N/c1-10(15(17)18)12-7-8-13(14(16)9-12)11-5-3-2-4-6-11;1-7(9)8-5-3-2-4-6-8/h2-10H,1H3,(H,17,18);2-7H,9H2,1H3/t10-;7-/m00/s1 |
| InChIKey | SXXYXEUZKYVLQA-DIQYCMFJSA-N |
| XLogP | 3.34 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |