C21H26FN2O4- — CID 19765938
2,6-diaminohexanoate;2-(3-fluoro-4-phenylphenyl)propanoic acid (PubChem CID 19765938) has the molecular formula C21H26FN2O4- and a molecular weight of 389.45 g/mol. Its IUPAC name is 2,6-diaminohexanoate;2-(3-fluoro-4-phenylphenyl)propanoic acid.
| Compound Name | 2,6-diaminohexanoate;2-(3-fluoro-4-phenylphenyl)propanoic acid |
|---|---|
| PubChem CID | 19765938 |
| Molecular Formula | C21H26FN2O4- |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 2,6-diaminohexanoate;2-(3-fluoro-4-phenylphenyl)propanoic acid |
| SMILES | CC(C(=O)O)c1ccc(-c2ccccc2)c(F)c1.NCCCCC(N)C(=O)[O-] |
| InChI | InChI=1S/C15H13FO2.C6H14N2O2/c1-10(15(17)18)12-7-8-13(14(16)9-12)11-5-3-2-4-6-11;7-4-2-1-3-5(8)6(9)10/h2-10H,1H3,(H,17,18);5H,1-4,7-8H2,(H,9,10)/p-1 |
| InChIKey | MVIXBFMRFFLICI-UHFFFAOYSA-M |
| XLogP | 1.87 |
| TPSA | 129.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|