About (2S)-2-(3-fluoro-4-phenylphenyl)propanoic acid;(2S)-3-methyl-2-phenylbutan-1-amine;sulfane
(2S)-2-(3-fluoro-4-phenylphenyl)propanoic acid;(2S)-3-methyl-2-phenylbutan-1-amine;sulfane (PubChem CID 160716259) has the molecular formula C26H34FNO2S2
and a molecular weight of 475.70 g/mol. Its IUPAC name is (2S)-2-(3-fluoro-4-phenylphenyl)propanoic acid;(2S)-3-methyl-2-phenylbutan-1-amine;sulfane.
Molecular Properties
| Compound Name | (2S)-2-(3-fluoro-4-phenylphenyl)propanoic acid;(2S)-3-methyl-2-phenylbutan-1-amine;sulfane |
| PubChem CID | 160716259 |
| Molecular Formula | C26H34FNO2S2 |
| Molecular Weight | 475.70 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | (2S)-2-(3-fluoro-4-phenylphenyl)propanoic acid;(2S)-3-methyl-2-phenylbutan-1-amine;sulfane |
| SMILES | CC(C)[C@H](CN)c1ccccc1.C[C@H](C(=O)O)c1ccc(-c2ccccc2)c(F)c1.S.S |
| InChI | InChI=1S/C15H13FO2.C11H17N.2H2S/c1-10(15(17)18)12-7-8-13(14(16)9-12)11-5-3-2-4-6-11;1-9(2)11(8-12)10-6-4-3-5-7-10;;/h2-10H,1H3,(H,17,18);3-7,9,11H,8,12H2,1-2H3;2*1H2/t10-;11-;;/m00../s1 |
| InChIKey | RSMYDPXURIYZBS-KMSDJKQTSA-N |
| XLogP | 6.29 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.70 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-(3-fluoro-4-phenylphenyl)propanoic acid;(2S)-3-methyl-2-phenylbutan-1-amine;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(3-fluoro-4-phenylphenyl)propanoic acid;(2S)-3-methyl-2-phenylbutan-1-amine;sulfane?
The IUPAC name of (2S)-2-(3-fluoro-4-phenylphenyl)propanoic acid;(2S)-3-methyl-2-phenylbutan-1-amine;sulfane (CID 160716259) is (2S)-2-(3-fluoro-4-phenylphenyl)propanoic acid;(2S)-3-methyl-2-phenylbutan-1-amine;sulfane.
What is the SMILES notation for (2S)-2-(3-fluoro-4-phenylphenyl)propanoic acid;(2S)-3-methyl-2-phenylbutan-1-amine;sulfane?
The canonical SMILES for (2S)-2-(3-fluoro-4-phenylphenyl)propanoic acid;(2S)-3-methyl-2-phenylbutan-1-amine;sulfane is CC(C)[C@H](CN)c1ccccc1.C[C@H](C(=O)O)c1ccc(-c2ccccc2)c(F)c1.S.S.
What is the InChIKey of (2S)-2-(3-fluoro-4-phenylphenyl)propanoic acid;(2S)-3-methyl-2-phenylbutan-1-amine;sulfane?
The InChIKey is RSMYDPXURIYZBS-KMSDJKQTSA-N. The full InChI is InChI=1S/C15H13FO2.C11H17N.2H2S/c1-10(15(17)18)12-7-8-13(14(16)9-12)11-5-3-2-4-6-11;1-9(2)11(8-12)10-6-4-3-5-7-10;;/h2-10H,1H3,(H,17,18);3-7,9,11H,8,12H2,1-2H3;2*1H2/t10-;11-;;/m00../s1.
What are the key properties of (2S)-2-(3-fluoro-4-phenylphenyl)propanoic acid;(2S)-3-methyl-2-phenylbutan-1-amine;sulfane?
(2S)-2-(3-fluoro-4-phenylphenyl)propanoic acid;(2S)-3-methyl-2-phenylbutan-1-amine;sulfane has a molecular weight of 475.70 g/mol, XLogP of 6.29, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(3-fluoro-4-phenylphenyl)propanoic acid;(2S)-3-methyl-2-phenylbutan-1-amine;sulfane is sourced from PubChem (CID 160716259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).