C28H23F — CID 101447551
4-[(2R)-4,4-diphenylbut-3-en-2-yl]-2-fluoro-1-phenylbenzene (PubChem CID 101447551) has the molecular formula C28H23F and a molecular weight of 378.49 g/mol. Its IUPAC name is 4-[(2R)-4,4-diphenylbut-3-en-2-yl]-2-fluoro-1-phenylbenzene.
| Compound Name | 4-[(2R)-4,4-diphenylbut-3-en-2-yl]-2-fluoro-1-phenylbenzene |
|---|---|
| PubChem CID | 101447551 |
| Molecular Formula | C28H23F |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 4-[(2R)-4,4-diphenylbut-3-en-2-yl]-2-fluoro-1-phenylbenzene |
| SMILES | C[C@H](C=C(c1ccccc1)c1ccccc1)c1ccc(-c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C28H23F/c1-21(25-17-18-26(28(29)20-25)22-11-5-2-6-12-22)19-27(23-13-7-3-8-14-23)24-15-9-4-10-16-24/h2-21H,1H3/t21-/m1/s1 |
| InChIKey | JYMMIZDPXPJSFB-OAQYLSRUSA-N |
| XLogP | 7.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |