C48H54F2N4O4 — CID 72544381
2-(3-fluoro-4-phenylphenyl)-N-[6-[[4-[6-[2-(3-fluoro-4-phenylphenyl)propanoylamino]hexylamino]-3,6-dioxocyclohexa-1,4-dien-1-yl]amino]hexyl]propanamide (PubChem CID 72544381) has the molecular formula C48H54F2N4O4 and a molecular weight of 788.98 g/mol. Its IUPAC name is 2-(3-fluoro-4-phenylphenyl)-N-[6-[[4-[6-[2-(3-fluoro-4-phenylphenyl)propanoylamino]hexylamino]-3,6-dioxocyclohexa-1,4-dien-1-yl]amino]hexyl]propanamide.
| Compound Name | 2-(3-fluoro-4-phenylphenyl)-N-[6-[[4-[6-[2-(3-fluoro-4-phenylphenyl)propanoylamino]hexylamino]-3,6-dioxocyclohexa-1,4-dien-1-yl]amino]hexyl]propanamide |
|---|---|
| PubChem CID | 72544381 |
| Molecular Formula | C48H54F2N4O4 |
| Molecular Weight | 788.98 g/mol |
| Exact Mass | 788.41 |
| IUPAC Name | 2-(3-fluoro-4-phenylphenyl)-N-[6-[[4-[6-[2-(3-fluoro-4-phenylphenyl)propanoylamino]hexylamino]-3,6-dioxocyclohexa-1,4-dien-1-yl]amino]hexyl]propanamide |
| SMILES | CC(C(=O)NCCCCCCNC1=CC(=O)C(NCCCCCCNC(=O)C(C)c2ccc(-c3ccccc3)c(F)c2)=CC1=O)c1ccc(-c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C48H54F2N4O4/c1-33(37-21-23-39(41(49)29-37)35-17-9-7-10-18-35)47(57)53-27-15-5-3-13-25-51-43-31-46(56)44(32-45(43)55)52-26-14-4-6-16-28-54-48(58)34(2)38-22-24-40(42(50)30-38)36-19-11-8-12-20-36/h7-12,17-24,29-34,51-52H,3-6,13-16,25-28H2,1-2H3,(H,53,57)(H,54,58) |
| InChIKey | IHPKWJKSEAEEAP-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.98 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|