C38H55FO6 — CID 95242609
[3-decanoyloxy-2-[(2S)-2-(3-fluoro-4-phenylphenyl)propanoyl]oxypropyl] decanoate (PubChem CID 95242609) has the molecular formula C38H55FO6 and a molecular weight of 626.85 g/mol. Its IUPAC name is [3-decanoyloxy-2-[(2S)-2-(3-fluoro-4-phenylphenyl)propanoyl]oxypropyl] decanoate.
| Compound Name | [3-decanoyloxy-2-[(2S)-2-(3-fluoro-4-phenylphenyl)propanoyl]oxypropyl] decanoate |
|---|---|
| PubChem CID | 95242609 |
| Molecular Formula | C38H55FO6 |
| Molecular Weight | 626.85 g/mol |
| Exact Mass | 626.40 |
| IUPAC Name | [3-decanoyloxy-2-[(2S)-2-(3-fluoro-4-phenylphenyl)propanoyl]oxypropyl] decanoate |
| SMILES | CCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC)OC(=O)[C@@H](C)c1ccc(-c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C38H55FO6/c1-4-6-8-10-12-14-19-23-36(40)43-28-33(29-44-37(41)24-20-15-13-11-9-7-5-2)45-38(42)30(3)32-25-26-34(35(39)27-32)31-21-17-16-18-22-31/h16-18,21-22,25-27,30,33H,4-15,19-20,23-24,28-29H2,1-3H3/t30-/m0/s1 |
| InChIKey | HUYMYDSMUYQDRB-PMERELPUSA-N |
| XLogP | 9.88 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.85 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|