C17H14FN3OS — CID 4680904
4-fluoro-N-[5-(1-phenylethyl)-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 4680904) has the molecular formula C17H14FN3OS and a molecular weight of 327.38 g/mol. Its IUPAC name is 4-fluoro-N-[5-(1-phenylethyl)-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-fluoro-N-[5-(1-phenylethyl)-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 4680904 |
| Molecular Formula | C17H14FN3OS |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 4-fluoro-N-[5-(1-phenylethyl)-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | CC(c1ccccc1)c1nnc(NC(=O)c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C17H14FN3OS/c1-11(12-5-3-2-4-6-12)16-20-21-17(23-16)19-15(22)13-7-9-14(18)10-8-13/h2-11H,1H3,(H,19,21,22) |
| InChIKey | GHXDIHGPINBETL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |