C20H21N3OS — CID 2963228
N-(5-pentan-2-yl-1,3,4-thiadiazol-2-yl)-4-phenylbenzamide (PubChem CID 2963228) has the molecular formula C20H21N3OS and a molecular weight of 351.47 g/mol. Its IUPAC name is N-(5-pentan-2-yl-1,3,4-thiadiazol-2-yl)-4-phenylbenzamide.
| Compound Name | N-(5-pentan-2-yl-1,3,4-thiadiazol-2-yl)-4-phenylbenzamide |
|---|---|
| PubChem CID | 2963228 |
| Molecular Formula | C20H21N3OS |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | N-(5-pentan-2-yl-1,3,4-thiadiazol-2-yl)-4-phenylbenzamide |
| SMILES | CCCC(C)c1nnc(NC(=O)c2ccc(-c3ccccc3)cc2)s1 |
| InChI | InChI=1S/C20H21N3OS/c1-3-7-14(2)19-22-23-20(25-19)21-18(24)17-12-10-16(11-13-17)15-8-5-4-6-9-15/h4-6,8-14H,3,7H2,1-2H3,(H,21,23,24) |
| InChIKey | UFHQXUATEBGUHZ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |