C28H33FN4O — CID 18693912
N-[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-3-yl]-1,1-di(piperidin-1-yl)methanimine (PubChem CID 18693912) has the molecular formula C28H33FN4O and a molecular weight of 460.60 g/mol. Its IUPAC name is N-[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-3-yl]-1,1-di(piperidin-1-yl)methanimine.
| Compound Name | N-[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-3-yl]-1,1-di(piperidin-1-yl)methanimine |
|---|---|
| PubChem CID | 18693912 |
| Molecular Formula | C28H33FN4O |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | N-[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-3-yl]-1,1-di(piperidin-1-yl)methanimine |
| SMILES | CC(c1ccc(-c2ccccc2)c(F)c1)c1cc(N=C(N2CCCCC2)N2CCCCC2)no1 |
| InChI | InChI=1S/C28H33FN4O/c1-21(23-13-14-24(25(29)19-23)22-11-5-2-6-12-22)26-20-27(31-34-26)30-28(32-15-7-3-8-16-32)33-17-9-4-10-18-33/h2,5-6,11-14,19-21H,3-4,7-10,15-18H2,1H3 |
| InChIKey | NDHBCKMOEMXWML-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|