C27H31FN4O4S — CID 139808582
tert-butyl N-[N-[3-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]-C-(1-oxo-1,4-thiazinan-4-yl)carbonimidoyl]carbamate (PubChem CID 139808582) has the molecular formula C27H31FN4O4S and a molecular weight of 526.63 g/mol. Its IUPAC name is tert-butyl N-[N-[3-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]-C-(1-oxo-1,4-thiazinan-4-yl)carbonimidoyl]carbamate.
| Compound Name | tert-butyl N-[N-[3-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]-C-(1-oxo-1,4-thiazinan-4-yl)carbonimidoyl]carbamate |
|---|---|
| PubChem CID | 139808582 |
| Molecular Formula | C27H31FN4O4S |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | tert-butyl N-[N-[3-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]-C-(1-oxo-1,4-thiazinan-4-yl)carbonimidoyl]carbamate |
| SMILES | CC(c1ccc(-c2ccccc2)c(F)c1)c1cc(N=C(NC(=O)OC(C)(C)C)N2CCS(=O)CC2)on1 |
| InChI | InChI=1S/C27H31FN4O4S/c1-18(20-10-11-21(22(28)16-20)19-8-6-5-7-9-19)23-17-24(36-31-23)29-25(30-26(33)35-27(2,3)4)32-12-14-37(34)15-13-32/h5-11,16-18H,12-15H2,1-4H3,(H,29,30,33) |
| InChIKey | JDIYMLNLFFMDHY-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|