C23H20FN5O — CID 70082136
1-[3-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]-1-pyridin-2-ylguanidine (PubChem CID 70082136) has the molecular formula C23H20FN5O and a molecular weight of 401.45 g/mol. Its IUPAC name is 1-[3-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]-1-pyridin-2-ylguanidine.
| Compound Name | 1-[3-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]-1-pyridin-2-ylguanidine |
|---|---|
| PubChem CID | 70082136 |
| Molecular Formula | C23H20FN5O |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 1-[3-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]-1-pyridin-2-ylguanidine |
| SMILES | [H]/N=C(\N)N(c1ccccn1)c1cc(C(C)c2ccc(-c3ccccc3)c(F)c2)no1 |
| InChI | InChI=1S/C23H20FN5O/c1-15(17-10-11-18(19(24)13-17)16-7-3-2-4-8-16)20-14-22(30-28-20)29(23(25)26)21-9-5-6-12-27-21/h2-15H,1H3,(H3,25,26) |
| InChIKey | AAVCZANTIKVFSZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 92.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|