C18H26N6O3 — CID 143847124
6-[(E)-[[6-amino-2-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]hydrazinylidene]methyl]-4-methylcyclohexa-2,4-dien-1-ol (PubChem CID 143847124) has the molecular formula C18H26N6O3 and a molecular weight of 374.45 g/mol. Its IUPAC name is 6-[(E)-[[6-amino-2-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]hydrazinylidene]methyl]-4-methylcyclohexa-2,4-dien-1-ol.
| Compound Name | 6-[(E)-[[6-amino-2-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]hydrazinylidene]methyl]-4-methylcyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 143847124 |
| Molecular Formula | C18H26N6O3 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 6-[(E)-[[6-amino-2-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]hydrazinylidene]methyl]-4-methylcyclohexa-2,4-dien-1-ol |
| SMILES | CC1=CC(/C=N/Nc2cc(N)nc(OCCN3CCOCC3)n2)C(O)C=C1 |
| InChI | InChI=1S/C18H26N6O3/c1-13-2-3-15(25)14(10-13)12-20-23-17-11-16(19)21-18(22-17)27-9-6-24-4-7-26-8-5-24/h2-3,10-12,14-15,25H,4-9H2,1H3,(H3,19,21,22,23)/b20-12+ |
| InChIKey | XVDWHOHHCWOXCB-UDWIEESQSA-N |
| XLogP | 0.66 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|