C23H19N7S — CID 88939875
6-N-[(E)-(3-methylphenyl)methylideneamino]-2-(5-pyridin-2-ylthiophen-2-yl)imidazo[1,2-b]pyridazine-6,8-diamine (PubChem CID 88939875) has the molecular formula C23H19N7S and a molecular weight of 425.52 g/mol. Its IUPAC name is 6-N-[(E)-(3-methylphenyl)methylideneamino]-2-(5-pyridin-2-ylthiophen-2-yl)imidazo[1,2-b]pyridazine-6,8-diamine.
| Compound Name | 6-N-[(E)-(3-methylphenyl)methylideneamino]-2-(5-pyridin-2-ylthiophen-2-yl)imidazo[1,2-b]pyridazine-6,8-diamine |
|---|---|
| PubChem CID | 88939875 |
| Molecular Formula | C23H19N7S |
| Molecular Weight | 425.52 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 6-N-[(E)-(3-methylphenyl)methylideneamino]-2-(5-pyridin-2-ylthiophen-2-yl)imidazo[1,2-b]pyridazine-6,8-diamine |
| SMILES | Cc1cccc(/C=N/Nc2cc(N)c3nc(-c4ccc(-c5ccccn5)s4)cn3n2)c1 |
| InChI | InChI=1S/C23H19N7S/c1-15-5-4-6-16(11-15)13-26-28-22-12-17(24)23-27-19(14-30(23)29-22)21-9-8-20(31-21)18-7-2-3-10-25-18/h2-14H,24H2,1H3,(H,28,29)/b26-13+ |
| InChIKey | ZDOCNOBXWSMQQQ-LGJNPRDNSA-N |
| XLogP | 4.86 |
| TPSA | 93.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|