C20H21N7 — CID 66684301
2-N,4-N-bis[(3-methylphenyl)methylideneamino]pyrimidine-2,4,6-triamine (PubChem CID 66684301) has the molecular formula C20H21N7 and a molecular weight of 359.44 g/mol. Its IUPAC name is 2-N,4-N-bis[(3-methylphenyl)methylideneamino]pyrimidine-2,4,6-triamine.
| Compound Name | 2-N,4-N-bis[(3-methylphenyl)methylideneamino]pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 66684301 |
| Molecular Formula | C20H21N7 |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 2-N,4-N-bis[(3-methylphenyl)methylideneamino]pyrimidine-2,4,6-triamine |
| SMILES | Cc1cccc(C=NNc2cc(N)nc(NN=Cc3cccc(C)c3)n2)c1 |
| InChI | InChI=1S/C20H21N7/c1-14-5-3-7-16(9-14)12-22-26-19-11-18(21)24-20(25-19)27-23-13-17-8-4-6-15(2)10-17/h3-13H,1-2H3,(H4,21,24,25,26,27) |
| InChIKey | AQOAMWDYUJBHNL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 100.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|