C20H29N5O — CID 155350711
4-[[5,6-diethyl-2-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]pyrimidin-4-yl]amino]butan-1-ol (PubChem CID 155350711) has the molecular formula C20H29N5O and a molecular weight of 355.49 g/mol. Its IUPAC name is 4-[[5,6-diethyl-2-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]pyrimidin-4-yl]amino]butan-1-ol.
| Compound Name | 4-[[5,6-diethyl-2-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]pyrimidin-4-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 155350711 |
| Molecular Formula | C20H29N5O |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | 4-[[5,6-diethyl-2-[(2E)-2-[(3-methylphenyl)methylidene]hydrazinyl]pyrimidin-4-yl]amino]butan-1-ol |
| SMILES | CCc1nc(N/N=C/c2cccc(C)c2)nc(NCCCCO)c1CC |
| InChI | InChI=1S/C20H29N5O/c1-4-17-18(5-2)23-20(24-19(17)21-11-6-7-12-26)25-22-14-16-10-8-9-15(3)13-16/h8-10,13-14,26H,4-7,11-12H2,1-3H3,(H2,21,23,24,25)/b22-14+ |
| InChIKey | OIUYVJGAPIHTPV-HYARGMPZSA-N |
| XLogP | 3.54 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|