C23H22ClN7O — CID 170724614
9-(4-chlorophenyl)-N-[(E)-(3-methylphenyl)methylideneamino]-2-morpholin-4-ylpurin-6-amine (PubChem CID 170724614) has the molecular formula C23H22ClN7O and a molecular weight of 447.93 g/mol. Its IUPAC name is 9-(4-chlorophenyl)-N-[(E)-(3-methylphenyl)methylideneamino]-2-morpholin-4-ylpurin-6-amine.
| Compound Name | 9-(4-chlorophenyl)-N-[(E)-(3-methylphenyl)methylideneamino]-2-morpholin-4-ylpurin-6-amine |
|---|---|
| PubChem CID | 170724614 |
| Molecular Formula | C23H22ClN7O |
| Molecular Weight | 447.93 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 9-(4-chlorophenyl)-N-[(E)-(3-methylphenyl)methylideneamino]-2-morpholin-4-ylpurin-6-amine |
| SMILES | Cc1cccc(/C=N/Nc2nc(N3CCOCC3)nc3c2ncn3-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C23H22ClN7O/c1-16-3-2-4-17(13-16)14-26-29-21-20-22(28-23(27-21)30-9-11-32-12-10-30)31(15-25-20)19-7-5-18(24)6-8-19/h2-8,13-15H,9-12H2,1H3,(H,27,28,29)/b26-14+ |
| InChIKey | OCOKKHSLJRTQKN-VULFUBBASA-N |
| XLogP | 4.06 |
| TPSA | 80.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.93 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|