C24H24N6O2 — CID 170724680
(E)-1-(3-methylphenyl)-N-(2-morpholin-4-yl-6-phenylmethoxypurin-9-yl)methanimine (PubChem CID 170724680) has the molecular formula C24H24N6O2 and a molecular weight of 428.50 g/mol. Its IUPAC name is (E)-1-(3-methylphenyl)-N-(2-morpholin-4-yl-6-phenylmethoxypurin-9-yl)methanimine.
| Compound Name | (E)-1-(3-methylphenyl)-N-(2-morpholin-4-yl-6-phenylmethoxypurin-9-yl)methanimine |
|---|---|
| PubChem CID | 170724680 |
| Molecular Formula | C24H24N6O2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | (E)-1-(3-methylphenyl)-N-(2-morpholin-4-yl-6-phenylmethoxypurin-9-yl)methanimine |
| SMILES | Cc1cccc(/C=N/n2cnc3c(OCc4ccccc4)nc(N4CCOCC4)nc32)c1 |
| InChI | InChI=1S/C24H24N6O2/c1-18-6-5-9-20(14-18)15-26-30-17-25-21-22(30)27-24(29-10-12-31-13-11-29)28-23(21)32-16-19-7-3-2-4-8-19/h2-9,14-15,17H,10-13,16H2,1H3/b26-15+ |
| InChIKey | PBDFKVKTNXYSOV-CVKSISIWSA-N |
| XLogP | 3.43 |
| TPSA | 77.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|