C15H23N9O2 — CID 170775454
3-(6-hydrazinyl-2-morpholin-4-ylpurin-9-yl)-N,N-dimethylazetidine-1-carboxamide (PubChem CID 170775454) has the molecular formula C15H23N9O2 and a molecular weight of 361.41 g/mol. Its IUPAC name is 3-(6-hydrazinyl-2-morpholin-4-ylpurin-9-yl)-N,N-dimethylazetidine-1-carboxamide.
| Compound Name | 3-(6-hydrazinyl-2-morpholin-4-ylpurin-9-yl)-N,N-dimethylazetidine-1-carboxamide |
|---|---|
| PubChem CID | 170775454 |
| Molecular Formula | C15H23N9O2 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | 3-(6-hydrazinyl-2-morpholin-4-ylpurin-9-yl)-N,N-dimethylazetidine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CC(n2cnc3c(NN)nc(N4CCOCC4)nc32)C1 |
| InChI | InChI=1S/C15H23N9O2/c1-21(2)15(25)23-7-10(8-23)24-9-17-11-12(20-16)18-14(19-13(11)24)22-3-5-26-6-4-22/h9-10H,3-8,16H2,1-2H3,(H,18,19,20) |
| InChIKey | XIDBFROAYGCPCF-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 117.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|