C15H15F3N8O — CID 170724597
[2-morpholin-4-yl-9-[2-(trifluoromethyl)-4-pyridinyl]purin-6-yl]hydrazine (PubChem CID 170724597) has the molecular formula C15H15F3N8O and a molecular weight of 380.33 g/mol. Its IUPAC name is [2-morpholin-4-yl-9-[2-(trifluoromethyl)-4-pyridinyl]purin-6-yl]hydrazine.
| Compound Name | [2-morpholin-4-yl-9-[2-(trifluoromethyl)-4-pyridinyl]purin-6-yl]hydrazine |
|---|---|
| PubChem CID | 170724597 |
| Molecular Formula | C15H15F3N8O |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | [2-morpholin-4-yl-9-[2-(trifluoromethyl)-4-pyridinyl]purin-6-yl]hydrazine |
| SMILES | NNc1nc(N2CCOCC2)nc2c1ncn2-c1ccnc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H15F3N8O/c16-15(17,18)10-7-9(1-2-20-10)26-8-21-11-12(24-19)22-14(23-13(11)26)25-3-5-27-6-4-25/h1-2,7-8H,3-6,19H2,(H,22,23,24) |
| InChIKey | TVNFVSASDVMOSU-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 107.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|