C23H21F2N9O — CID 78333447
9-(4-aminophenyl)-N-[(4,5-difluoro-1H-benzimidazol-2-yl)methyl]-2-morpholin-4-ylpurin-6-amine (PubChem CID 78333447) has the molecular formula C23H21F2N9O and a molecular weight of 477.48 g/mol. Its IUPAC name is 9-(4-aminophenyl)-N-[(4,5-difluoro-1H-benzimidazol-2-yl)methyl]-2-morpholin-4-ylpurin-6-amine.
| Compound Name | 9-(4-aminophenyl)-N-[(4,5-difluoro-1H-benzimidazol-2-yl)methyl]-2-morpholin-4-ylpurin-6-amine |
|---|---|
| PubChem CID | 78333447 |
| Molecular Formula | C23H21F2N9O |
| Molecular Weight | 477.48 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | 9-(4-aminophenyl)-N-[(4,5-difluoro-1H-benzimidazol-2-yl)methyl]-2-morpholin-4-ylpurin-6-amine |
| SMILES | Nc1ccc(-n2cnc3c(NCc4nc5c(F)c(F)ccc5[nH]4)nc(N4CCOCC4)nc32)cc1 |
| InChI | InChI=1S/C23H21F2N9O/c24-15-5-6-16-19(18(15)25)30-17(29-16)11-27-21-20-22(32-23(31-21)33-7-9-35-10-8-33)34(12-28-20)14-3-1-13(26)2-4-14/h1-6,12H,7-11,26H2,(H,29,30)(H,27,31,32) |
| InChIKey | XYTWZFGEDUXBNC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 122.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|