C18H17BrN6OS2 — CID 53245507
N-[(5-bromothiophen-2-yl)methyl]-2-morpholin-4-yl-9-thiophen-3-ylpurin-6-amine (PubChem CID 53245507) has the molecular formula C18H17BrN6OS2 and a molecular weight of 477.41 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-2-morpholin-4-yl-9-thiophen-3-ylpurin-6-amine.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-2-morpholin-4-yl-9-thiophen-3-ylpurin-6-amine |
|---|---|
| PubChem CID | 53245507 |
| Molecular Formula | C18H17BrN6OS2 |
| Molecular Weight | 477.41 g/mol |
| Exact Mass | 476.01 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-2-morpholin-4-yl-9-thiophen-3-ylpurin-6-amine |
| SMILES | Brc1ccc(CNc2nc(N3CCOCC3)nc3c2ncn3-c2ccsc2)s1 |
| InChI | InChI=1S/C18H17BrN6OS2/c19-14-2-1-13(28-14)9-20-16-15-17(25(11-21-15)12-3-8-27-10-12)23-18(22-16)24-4-6-26-7-5-24/h1-3,8,10-11H,4-7,9H2,(H,20,22,23) |
| InChIKey | NACIUPNQGNQIPO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |