C26H42N8O2 — CID 117085252
9-cyclohexyl-N-(2-morpholin-4-ylethyl)-2-(4-morpholin-4-ylpiperidin-1-yl)purin-6-amine (PubChem CID 117085252) has the molecular formula C26H42N8O2 and a molecular weight of 498.68 g/mol. Its IUPAC name is 9-cyclohexyl-N-(2-morpholin-4-ylethyl)-2-(4-morpholin-4-ylpiperidin-1-yl)purin-6-amine.
| Compound Name | 9-cyclohexyl-N-(2-morpholin-4-ylethyl)-2-(4-morpholin-4-ylpiperidin-1-yl)purin-6-amine |
|---|---|
| PubChem CID | 117085252 |
| Molecular Formula | C26H42N8O2 |
| Molecular Weight | 498.68 g/mol |
| Exact Mass | 498.34 |
| IUPAC Name | 9-cyclohexyl-N-(2-morpholin-4-ylethyl)-2-(4-morpholin-4-ylpiperidin-1-yl)purin-6-amine |
| SMILES | c1nc2c(NCCN3CCOCC3)nc(N3CCC(N4CCOCC4)CC3)nc2n1C1CCCCC1 |
| InChI | InChI=1S/C26H42N8O2/c1-2-4-22(5-3-1)34-20-28-23-24(27-8-11-31-12-16-35-17-13-31)29-26(30-25(23)34)33-9-6-21(7-10-33)32-14-18-36-19-15-32/h20-22H,1-19H2,(H,27,29,30) |
| InChIKey | PRJAFIIVYGYXOG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.68 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |