C21H32ClN7O — CID 18001854
2-chloro-9-cyclopentyl-N-[4-(2-morpholin-4-ylethyl)piperidin-1-yl]purin-6-amine (PubChem CID 18001854) has the molecular formula C21H32ClN7O and a molecular weight of 433.99 g/mol. Its IUPAC name is 2-chloro-9-cyclopentyl-N-[4-(2-morpholin-4-ylethyl)piperidin-1-yl]purin-6-amine.
| Compound Name | 2-chloro-9-cyclopentyl-N-[4-(2-morpholin-4-ylethyl)piperidin-1-yl]purin-6-amine |
|---|---|
| PubChem CID | 18001854 |
| Molecular Formula | C21H32ClN7O |
| Molecular Weight | 433.99 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | 2-chloro-9-cyclopentyl-N-[4-(2-morpholin-4-ylethyl)piperidin-1-yl]purin-6-amine |
| SMILES | Clc1nc(NN2CCC(CCN3CCOCC3)CC2)c2ncn(C3CCCC3)c2n1 |
| InChI | InChI=1S/C21H32ClN7O/c22-21-24-19(18-20(25-21)29(15-23-18)17-3-1-2-4-17)26-28-9-6-16(7-10-28)5-8-27-11-13-30-14-12-27/h15-17H,1-14H2,(H,24,25,26) |
| InChIKey | BNLMZHABEOOKPV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.99 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |