C25H34ClN7 — CID 57231582
2-chloro-9-cyclopentyl-6-[2-[4-(2-pyrrolidin-1-ylethyl)piperidin-1-yl]pyrrol-2-yl]purine (PubChem CID 57231582) has the molecular formula C25H34ClN7 and a molecular weight of 468.05 g/mol. Its IUPAC name is 2-chloro-9-cyclopentyl-6-[2-[4-(2-pyrrolidin-1-ylethyl)piperidin-1-yl]pyrrol-2-yl]purine.
| Compound Name | 2-chloro-9-cyclopentyl-6-[2-[4-(2-pyrrolidin-1-ylethyl)piperidin-1-yl]pyrrol-2-yl]purine |
|---|---|
| PubChem CID | 57231582 |
| Molecular Formula | C25H34ClN7 |
| Molecular Weight | 468.05 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | 2-chloro-9-cyclopentyl-6-[2-[4-(2-pyrrolidin-1-ylethyl)piperidin-1-yl]pyrrol-2-yl]purine |
| SMILES | Clc1nc(C2(N3CCC(CCN4CCCC4)CC3)C=CC=N2)c2ncn(C3CCCC3)c2n1 |
| InChI | InChI=1S/C25H34ClN7/c26-24-29-22(21-23(30-24)33(18-27-21)20-6-1-2-7-20)25(11-5-12-28-25)32-16-9-19(10-17-32)8-15-31-13-3-4-14-31/h5,11-12,18-20H,1-4,6-10,13-17H2 |
| InChIKey | LOICLPGXMGGHFE-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 62.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.05 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |