C19H29ClN6O — CID 18001801
2-chloro-9-cyclopentyl-N-[4-(1-methoxypropyl)piperidin-1-yl]purin-6-amine (PubChem CID 18001801) has the molecular formula C19H29ClN6O and a molecular weight of 392.94 g/mol. Its IUPAC name is 2-chloro-9-cyclopentyl-N-[4-(1-methoxypropyl)piperidin-1-yl]purin-6-amine.
| Compound Name | 2-chloro-9-cyclopentyl-N-[4-(1-methoxypropyl)piperidin-1-yl]purin-6-amine |
|---|---|
| PubChem CID | 18001801 |
| Molecular Formula | C19H29ClN6O |
| Molecular Weight | 392.94 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 2-chloro-9-cyclopentyl-N-[4-(1-methoxypropyl)piperidin-1-yl]purin-6-amine |
| SMILES | CCC(OC)C1CCN(Nc2nc(Cl)nc3c2ncn3C2CCCC2)CC1 |
| InChI | InChI=1S/C19H29ClN6O/c1-3-15(27-2)13-8-10-25(11-9-13)24-17-16-18(23-19(20)22-17)26(12-21-16)14-6-4-5-7-14/h12-15H,3-11H2,1-2H3,(H,22,23,24) |
| InChIKey | CMFONDASJJIVER-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.94 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |