C26H46ClN7 — CID 18001693
2-chloro-9-cyclopentyl-N-(4-pentylpiperidin-1-yl)purin-6-amine;N-propylpropan-1-amine (PubChem CID 18001693) has the molecular formula C26H46ClN7 and a molecular weight of 492.16 g/mol. Its IUPAC name is 2-chloro-9-cyclopentyl-N-(4-pentylpiperidin-1-yl)purin-6-amine;N-propylpropan-1-amine.
| Compound Name | 2-chloro-9-cyclopentyl-N-(4-pentylpiperidin-1-yl)purin-6-amine;N-propylpropan-1-amine |
|---|---|
| PubChem CID | 18001693 |
| Molecular Formula | C26H46ClN7 |
| Molecular Weight | 492.16 g/mol |
| Exact Mass | 491.35 |
| IUPAC Name | 2-chloro-9-cyclopentyl-N-(4-pentylpiperidin-1-yl)purin-6-amine;N-propylpropan-1-amine |
| SMILES | CCCCCC1CCN(Nc2nc(Cl)nc3c2ncn3C2CCCC2)CC1.CCCNCCC |
| InChI | InChI=1S/C20H31ClN6.C6H15N/c1-2-3-4-7-15-10-12-26(13-11-15)25-18-17-19(24-20(21)23-18)27(14-22-17)16-8-5-6-9-16;1-3-5-7-6-4-2/h14-16H,2-13H2,1H3,(H,23,24,25);7H,3-6H2,1-2H3 |
| InChIKey | GBYMFKGXYLDJKO-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.16 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|