C28H48N8O — CID 18002178
2-N-(4-aminocyclohexyl)-6-N-[4-(1-butoxypropyl)piperidin-1-yl]-9-cyclopentylpurine-2,6-diamine (PubChem CID 18002178) has the molecular formula C28H48N8O and a molecular weight of 512.75 g/mol. Its IUPAC name is 2-N-(4-aminocyclohexyl)-6-N-[4-(1-butoxypropyl)piperidin-1-yl]-9-cyclopentylpurine-2,6-diamine.
| Compound Name | 2-N-(4-aminocyclohexyl)-6-N-[4-(1-butoxypropyl)piperidin-1-yl]-9-cyclopentylpurine-2,6-diamine |
|---|---|
| PubChem CID | 18002178 |
| Molecular Formula | C28H48N8O |
| Molecular Weight | 512.75 g/mol |
| Exact Mass | 512.40 |
| IUPAC Name | 2-N-(4-aminocyclohexyl)-6-N-[4-(1-butoxypropyl)piperidin-1-yl]-9-cyclopentylpurine-2,6-diamine |
| SMILES | CCCCOC(CC)C1CCN(Nc2nc(NC3CCC(N)CC3)nc3c2ncn3C2CCCC2)CC1 |
| InChI | InChI=1S/C28H48N8O/c1-3-5-18-37-24(4-2)20-14-16-35(17-15-20)34-26-25-27(36(19-30-25)23-8-6-7-9-23)33-28(32-26)31-22-12-10-21(29)11-13-22/h19-24H,3-18,29H2,1-2H3,(H2,31,32,33,34) |
| InChIKey | XYDLSFSUBBWPEW-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 106.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.75 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|