C29H50N8O — CID 70033581
2-N-(4-aminocyclohexyl)-6-N-(1-butoxybutyl)-9-cyclopentyl-6-N-piperidin-1-ylpurine-2,6-diamine (PubChem CID 70033581) has the molecular formula C29H50N8O and a molecular weight of 526.77 g/mol. Its IUPAC name is 2-N-(4-aminocyclohexyl)-6-N-(1-butoxybutyl)-9-cyclopentyl-6-N-piperidin-1-ylpurine-2,6-diamine.
| Compound Name | 2-N-(4-aminocyclohexyl)-6-N-(1-butoxybutyl)-9-cyclopentyl-6-N-piperidin-1-ylpurine-2,6-diamine |
|---|---|
| PubChem CID | 70033581 |
| Molecular Formula | C29H50N8O |
| Molecular Weight | 526.77 g/mol |
| Exact Mass | 526.41 |
| IUPAC Name | 2-N-(4-aminocyclohexyl)-6-N-(1-butoxybutyl)-9-cyclopentyl-6-N-piperidin-1-ylpurine-2,6-diamine |
| SMILES | CCCCOC(CCC)N(c1nc(NC2CCC(N)CC2)nc2c1ncn2C1CCCC1)N1CCCCC1 |
| InChI | InChI=1S/C29H50N8O/c1-3-5-20-38-25(11-4-2)37(35-18-9-6-10-19-35)28-26-27(36(21-31-26)24-12-7-8-13-24)33-29(34-28)32-23-16-14-22(30)15-17-23/h21-25H,3-20,30H2,1-2H3,(H,32,33,34) |
| InChIKey | MMMYSKTUAUMXBM-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.77 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|