C18H30N8O — CID 18473413
2-[amino-[2-[(4-aminocyclohexyl)amino]-9-cyclopentylpurin-6-yl]amino]ethanol (PubChem CID 18473413) has the molecular formula C18H30N8O and a molecular weight of 374.49 g/mol. Its IUPAC name is 2-[amino-[2-[(4-aminocyclohexyl)amino]-9-cyclopentylpurin-6-yl]amino]ethanol.
| Compound Name | 2-[amino-[2-[(4-aminocyclohexyl)amino]-9-cyclopentylpurin-6-yl]amino]ethanol |
|---|---|
| PubChem CID | 18473413 |
| Molecular Formula | C18H30N8O |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | 2-[amino-[2-[(4-aminocyclohexyl)amino]-9-cyclopentylpurin-6-yl]amino]ethanol |
| SMILES | NC1CCC(Nc2nc(N(N)CCO)c3ncn(C4CCCC4)c3n2)CC1 |
| InChI | InChI=1S/C18H30N8O/c19-12-5-7-13(8-6-12)22-18-23-16-15(17(24-18)26(20)9-10-27)21-11-25(16)14-3-1-2-4-14/h11-14,27H,1-10,19-20H2,(H,22,23,24) |
| InChIKey | CBKRCOOWUDNOKU-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 131.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|