C24H32N8 — CID 69349660
acetonitrile;2-N-(4-aminocyclohexyl)-9-cyclopentyl-6-N-phenylpurine-2,6-diamine (PubChem CID 69349660) has the molecular formula C24H32N8 and a molecular weight of 432.58 g/mol. Its IUPAC name is acetonitrile;2-N-(4-aminocyclohexyl)-9-cyclopentyl-6-N-phenylpurine-2,6-diamine.
| Compound Name | acetonitrile;2-N-(4-aminocyclohexyl)-9-cyclopentyl-6-N-phenylpurine-2,6-diamine |
|---|---|
| PubChem CID | 69349660 |
| Molecular Formula | C24H32N8 |
| Molecular Weight | 432.58 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | acetonitrile;2-N-(4-aminocyclohexyl)-9-cyclopentyl-6-N-phenylpurine-2,6-diamine |
| SMILES | CC#N.NC1CCC(Nc2nc(Nc3ccccc3)c3ncn(C4CCCC4)c3n2)CC1 |
| InChI | InChI=1S/C22H29N7.C2H3N/c23-15-10-12-17(13-11-15)26-22-27-20(25-16-6-2-1-3-7-16)19-21(28-22)29(14-24-19)18-8-4-5-9-18;1-2-3/h1-3,6-7,14-15,17-18H,4-5,8-13,23H2,(H2,25,26,27,28);1H3 |
| InChIKey | HBQHZDBZKUBMRB-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 117.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.58 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |