C23H36ClN7 — CID 18001939
2-chloro-9-cyclopentyl-N-[4-(3-piperidin-1-ylpropyl)piperidin-1-yl]purin-6-amine (PubChem CID 18001939) has the molecular formula C23H36ClN7 and a molecular weight of 446.04 g/mol. Its IUPAC name is 2-chloro-9-cyclopentyl-N-[4-(3-piperidin-1-ylpropyl)piperidin-1-yl]purin-6-amine.
| Compound Name | 2-chloro-9-cyclopentyl-N-[4-(3-piperidin-1-ylpropyl)piperidin-1-yl]purin-6-amine |
|---|---|
| PubChem CID | 18001939 |
| Molecular Formula | C23H36ClN7 |
| Molecular Weight | 446.04 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | 2-chloro-9-cyclopentyl-N-[4-(3-piperidin-1-ylpropyl)piperidin-1-yl]purin-6-amine |
| SMILES | Clc1nc(NN2CCC(CCCN3CCCCC3)CC2)c2ncn(C3CCCC3)c2n1 |
| InChI | InChI=1S/C23H36ClN7/c24-23-26-21(20-22(27-23)31(17-25-20)19-8-2-3-9-19)28-30-15-10-18(11-16-30)7-6-14-29-12-4-1-5-13-29/h17-19H,1-16H2,(H,26,27,28) |
| InChIKey | CGTXXYAYSQXMDT-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.04 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |