C25H44ClN7 — CID 18002086
N-butylbutan-1-amine;2-chloro-9-cyclopentyl-N-(4-ethylpiperidin-1-yl)purin-6-amine (PubChem CID 18002086) has the molecular formula C25H44ClN7 and a molecular weight of 478.13 g/mol. Its IUPAC name is N-butylbutan-1-amine;2-chloro-9-cyclopentyl-N-(4-ethylpiperidin-1-yl)purin-6-amine.
| Compound Name | N-butylbutan-1-amine;2-chloro-9-cyclopentyl-N-(4-ethylpiperidin-1-yl)purin-6-amine |
|---|---|
| PubChem CID | 18002086 |
| Molecular Formula | C25H44ClN7 |
| Molecular Weight | 478.13 g/mol |
| Exact Mass | 477.33 |
| IUPAC Name | N-butylbutan-1-amine;2-chloro-9-cyclopentyl-N-(4-ethylpiperidin-1-yl)purin-6-amine |
| SMILES | CCC1CCN(Nc2nc(Cl)nc3c2ncn3C2CCCC2)CC1.CCCCNCCCC |
| InChI | InChI=1S/C17H25ClN6.C8H19N/c1-2-12-7-9-23(10-8-12)22-15-14-16(21-17(18)20-15)24(11-19-14)13-5-3-4-6-13;1-3-5-7-9-8-6-4-2/h11-13H,2-10H2,1H3,(H,20,21,22);9H,3-8H2,1-2H3 |
| InChIKey | PEOUDMMQPAUPIA-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.13 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|