C27H45N9 — CID 18002277
2-N-(1-aminocyclohexyl)-9-cyclopentyl-6-N-[4-(2-pyrrolidin-1-ylethyl)piperidin-1-yl]purine-2,6-diamine (PubChem CID 18002277) has the molecular formula C27H45N9 and a molecular weight of 495.72 g/mol. Its IUPAC name is 2-N-(1-aminocyclohexyl)-9-cyclopentyl-6-N-[4-(2-pyrrolidin-1-ylethyl)piperidin-1-yl]purine-2,6-diamine.
| Compound Name | 2-N-(1-aminocyclohexyl)-9-cyclopentyl-6-N-[4-(2-pyrrolidin-1-ylethyl)piperidin-1-yl]purine-2,6-diamine |
|---|---|
| PubChem CID | 18002277 |
| Molecular Formula | C27H45N9 |
| Molecular Weight | 495.72 g/mol |
| Exact Mass | 495.38 |
| IUPAC Name | 2-N-(1-aminocyclohexyl)-9-cyclopentyl-6-N-[4-(2-pyrrolidin-1-ylethyl)piperidin-1-yl]purine-2,6-diamine |
| SMILES | NC1(Nc2nc(NN3CCC(CCN4CCCC4)CC3)c3ncn(C4CCCC4)c3n2)CCCCC1 |
| InChI | InChI=1S/C27H45N9/c28-27(13-4-1-5-14-27)32-26-30-24(23-25(31-26)36(20-29-23)22-8-2-3-9-22)33-35-18-11-21(12-19-35)10-17-34-15-6-7-16-34/h20-22H,1-19,28H2,(H2,30,31,32,33) |
| InChIKey | SPNSTOOMNWMAKO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.72 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|